C18H21Cl2N3O2 — CID 127050806
2-(2,5-dichlorophenyl)-6-(3-piperidin-1-ylpropoxy)pyridazin-3-one (PubChem CID 127050806) has the molecular formula C18H21Cl2N3O2 and a molecular weight of 382.29 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-6-(3-piperidin-1-ylpropoxy)pyridazin-3-one.
| Compound Name | 2-(2,5-dichlorophenyl)-6-(3-piperidin-1-ylpropoxy)pyridazin-3-one |
|---|---|
| PubChem CID | 127050806 |
| Molecular Formula | C18H21Cl2N3O2 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-6-(3-piperidin-1-ylpropoxy)pyridazin-3-one |
| SMILES | O=c1ccc(OCCCN2CCCCC2)nn1-c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H21Cl2N3O2/c19-14-5-6-15(20)16(13-14)23-18(24)8-7-17(21-23)25-12-4-11-22-9-2-1-3-10-22/h5-8,13H,1-4,9-12H2 |
| InChIKey | RLJSTWOMEJIIBA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|