C25H25ClN2O7S — CID 127052627
N-[(3R,4R,5S,6R)-6-[[(3-chlorophenyl)sulfonylamino]methyl]-2,4,5-trihydroxyoxan-3-yl]-3-phenylbenzamide (PubChem CID 127052627) has the molecular formula C25H25ClN2O7S and a molecular weight of 533.00 g/mol. Its IUPAC name is N-[(3R,4R,5S,6R)-6-[[(3-chlorophenyl)sulfonylamino]methyl]-2,4,5-trihydroxyoxan-3-yl]-3-phenylbenzamide.
| Compound Name | N-[(3R,4R,5S,6R)-6-[[(3-chlorophenyl)sulfonylamino]methyl]-2,4,5-trihydroxyoxan-3-yl]-3-phenylbenzamide |
|---|---|
| PubChem CID | 127052627 |
| Molecular Formula | C25H25ClN2O7S |
| Molecular Weight | 533.00 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | N-[(3R,4R,5S,6R)-6-[[(3-chlorophenyl)sulfonylamino]methyl]-2,4,5-trihydroxyoxan-3-yl]-3-phenylbenzamide |
| SMILES | O=C(N[C@H]1C(O)O[C@H](CNS(=O)(=O)c2cccc(Cl)c2)[C@@H](O)[C@@H]1O)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C25H25ClN2O7S/c26-18-10-5-11-19(13-18)36(33,34)27-14-20-22(29)23(30)21(25(32)35-20)28-24(31)17-9-4-8-16(12-17)15-6-2-1-3-7-15/h1-13,20-23,25,27,29-30,32H,14H2,(H,28,31)/t20-,21-,22-,23-,25?/m1/s1 |
| InChIKey | POFDPQACEBXYOE-OQPYTZTLSA-N |
| XLogP | 1.52 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.00 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |