C25H26N2O7S — CID 57411333
N-[(3R,4R,5S,6R)-6-(benzenesulfonamidomethyl)-2,4,5-trihydroxyoxan-3-yl]-3-phenylbenzamide (PubChem CID 57411333) has the molecular formula C25H26N2O7S and a molecular weight of 498.56 g/mol. Its IUPAC name is N-[(3R,4R,5S,6R)-6-(benzenesulfonamidomethyl)-2,4,5-trihydroxyoxan-3-yl]-3-phenylbenzamide.
| Compound Name | N-[(3R,4R,5S,6R)-6-(benzenesulfonamidomethyl)-2,4,5-trihydroxyoxan-3-yl]-3-phenylbenzamide |
|---|---|
| PubChem CID | 57411333 |
| Molecular Formula | C25H26N2O7S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | N-[(3R,4R,5S,6R)-6-(benzenesulfonamidomethyl)-2,4,5-trihydroxyoxan-3-yl]-3-phenylbenzamide |
| SMILES | O=C(N[C@H]1C(O)O[C@H](CNS(=O)(=O)c2ccccc2)[C@@H](O)[C@@H]1O)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C25H26N2O7S/c28-22-20(15-26-35(32,33)19-12-5-2-6-13-19)34-25(31)21(23(22)29)27-24(30)18-11-7-10-17(14-18)16-8-3-1-4-9-16/h1-14,20-23,25-26,28-29,31H,15H2,(H,27,30)/t20-,21-,22-,23-,25?/m1/s1 |
| InChIKey | VBRJQJSSBBQIMY-OQPYTZTLSA-N |
| XLogP | 0.87 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |