C16H24N2O8S — CID 166628389
N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxyoxan-3-yl]-4-sulfamoylbenzamide (PubChem CID 166628389) has the molecular formula C16H24N2O8S and a molecular weight of 404.44 g/mol. Its IUPAC name is N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxyoxan-3-yl]-4-sulfamoylbenzamide.
| Compound Name | N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxyoxan-3-yl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 166628389 |
| Molecular Formula | C16H24N2O8S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-propan-2-yloxyoxan-3-yl]-4-sulfamoylbenzamide |
| SMILES | CC(C)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NC(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H24N2O8S/c1-8(2)25-16-12(14(21)13(20)11(7-19)26-16)18-15(22)9-3-5-10(6-4-9)27(17,23)24/h3-6,8,11-14,16,19-21H,7H2,1-2H3,(H,18,22)(H2,17,23,24)/t11-,12-,13-,14-,16-/m1/s1 |
| InChIKey | JOCTYTTWXFJGIJ-UTGUJQJDSA-N |
| XLogP | -1.70 |
| TPSA | 168.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |