C21H20F4N6O3 — CID 127053838
2-fluoro-N-methyl-5-[[4-[3-[4-(trifluoromethoxy)phenoxy]propylamino]-1,3,5-triazin-2-yl]amino]benzamide (PubChem CID 127053838) has the molecular formula C21H20F4N6O3 and a molecular weight of 480.42 g/mol. Its IUPAC name is 2-fluoro-N-methyl-5-[[4-[3-[4-(trifluoromethoxy)phenoxy]propylamino]-1,3,5-triazin-2-yl]amino]benzamide.
| Compound Name | 2-fluoro-N-methyl-5-[[4-[3-[4-(trifluoromethoxy)phenoxy]propylamino]-1,3,5-triazin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 127053838 |
| Molecular Formula | C21H20F4N6O3 |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 2-fluoro-N-methyl-5-[[4-[3-[4-(trifluoromethoxy)phenoxy]propylamino]-1,3,5-triazin-2-yl]amino]benzamide |
| SMILES | CNC(=O)c1cc(Nc2ncnc(NCCCOc3ccc(OC(F)(F)F)cc3)n2)ccc1F |
| InChI | InChI=1S/C21H20F4N6O3/c1-26-18(32)16-11-13(3-8-17(16)22)30-20-29-12-28-19(31-20)27-9-2-10-33-14-4-6-15(7-5-14)34-21(23,24)25/h3-8,11-12H,2,9-10H2,1H3,(H,26,32)(H2,27,28,29,30,31) |
| InChIKey | SWLLHMGAVJQGKA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|