C16H16O7 — CID 127054549
4,8,9a-trihydroxy-1-methoxy-4a,6-dimethyl-4H-xanthene-3,9-dione (PubChem CID 127054549) has the molecular formula C16H16O7 and a molecular weight of 320.30 g/mol. Its IUPAC name is 4,8,9a-trihydroxy-1-methoxy-4a,6-dimethyl-4H-xanthene-3,9-dione.
| Compound Name | 4,8,9a-trihydroxy-1-methoxy-4a,6-dimethyl-4H-xanthene-3,9-dione |
|---|---|
| PubChem CID | 127054549 |
| Molecular Formula | C16H16O7 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 4,8,9a-trihydroxy-1-methoxy-4a,6-dimethyl-4H-xanthene-3,9-dione |
| SMILES | COC1=CC(=O)C(O)C2(C)Oc3cc(C)cc(O)c3C(=O)C12O |
| InChI | InChI=1S/C16H16O7/c1-7-4-8(17)12-10(5-7)23-15(2)13(19)9(18)6-11(22-3)16(15,21)14(12)20/h4-6,13,17,19,21H,1-3H3 |
| InChIKey | TTWJBJFXBDPUND-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |