About methoxy(dipentyl)borane
methoxy(dipentyl)borane (PubChem CID 12705652) has the molecular formula C11H25BO
and a molecular weight of 184.13 g/mol. Its IUPAC name is methoxy(dipentyl)borane.
Molecular Properties
| Compound Name | methoxy(dipentyl)borane |
| PubChem CID | 12705652 |
| Molecular Formula | C11H25BO |
| Molecular Weight | 184.13 g/mol |
| Exact Mass | 184.20 |
| IUPAC Name | methoxy(dipentyl)borane |
| SMILES | CCCCCB(CCCCC)OC |
| InChI | InChI=1S/C11H25BO/c1-4-6-8-10-12(13-3)11-9-7-5-2/h4-11H2,1-3H3 |
| InChIKey | RJTZVPJMAWUDGR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.13 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methoxy(dipentyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxy(dipentyl)borane?
The IUPAC name of methoxy(dipentyl)borane (CID 12705652) is methoxy(dipentyl)borane.
What is the SMILES notation for methoxy(dipentyl)borane?
The canonical SMILES for methoxy(dipentyl)borane is CCCCCB(CCCCC)OC.
What is the InChIKey of methoxy(dipentyl)borane?
The InChIKey is RJTZVPJMAWUDGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25BO/c1-4-6-8-10-12(13-3)11-9-7-5-2/h4-11H2,1-3H3.
What are the key properties of methoxy(dipentyl)borane?
methoxy(dipentyl)borane has a molecular weight of 184.13 g/mol, XLogP of 4.00, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methoxy(dipentyl)borane is sourced from PubChem (CID 12705652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).