About octadecylboronic acid
octadecylboronic acid (PubChem CID 521161) has the molecular formula C18H39BO2
and a molecular weight of 298.32 g/mol. Its IUPAC name is octadecylboronic acid.
Molecular Properties
| Compound Name | octadecylboronic acid |
| PubChem CID | 521161 |
| Molecular Formula | C18H39BO2 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.30 |
| IUPAC Name | octadecylboronic acid |
| SMILES | CCCCCCCCCCCCCCCCCCB(O)O |
| InChI | InChI=1S/C18H39BO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h20-21H,2-18H2,1H3 |
| InChIKey | HGDBMZFQJKWYNK-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze octadecylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecylboronic acid?
The IUPAC name of octadecylboronic acid (CID 521161) is octadecylboronic acid.
What is the SMILES notation for octadecylboronic acid?
The canonical SMILES for octadecylboronic acid is CCCCCCCCCCCCCCCCCCB(O)O.
What is the InChIKey of octadecylboronic acid?
The InChIKey is HGDBMZFQJKWYNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39BO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h20-21H,2-18H2,1H3.
What are the key properties of octadecylboronic acid?
octadecylboronic acid has a molecular weight of 298.32 g/mol, XLogP of 5.72, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octadecylboronic acid is sourced from PubChem (CID 521161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).