About tetradecylboronic acid
tetradecylboronic acid (PubChem CID 3528229) has the molecular formula C14H31BO2
and a molecular weight of 242.21 g/mol. Its IUPAC name is tetradecylboronic acid.
Molecular Properties
| Compound Name | tetradecylboronic acid |
| PubChem CID | 3528229 |
| Molecular Formula | C14H31BO2 |
| Molecular Weight | 242.21 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | tetradecylboronic acid |
| SMILES | CCCCCCCCCCCCCCB(O)O |
| InChI | InChI=1S/C14H31BO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h16-17H,2-14H2,1H3 |
| InChIKey | MCUAMUGSKSODIJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.21 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tetradecylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetradecylboronic acid?
The IUPAC name of tetradecylboronic acid (CID 3528229) is tetradecylboronic acid.
What is the SMILES notation for tetradecylboronic acid?
The canonical SMILES for tetradecylboronic acid is CCCCCCCCCCCCCCB(O)O.
What is the InChIKey of tetradecylboronic acid?
The InChIKey is MCUAMUGSKSODIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31BO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h16-17H,2-14H2,1H3.
What are the key properties of tetradecylboronic acid?
tetradecylboronic acid has a molecular weight of 242.21 g/mol, XLogP of 4.16, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tetradecylboronic acid is sourced from PubChem (CID 3528229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).