About CID 156634462
CID 156634462 (PubChem CID 156634462) has the molecular formula C10H23B2O3
and a molecular weight of 212.91 g/mol.
Molecular Properties
| Compound Name | CID 156634462 |
| PubChem CID | 156634462 |
| Molecular Formula | C10H23B2O3 |
| Molecular Weight | 212.91 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCCB(O)O[B]O |
| InChI | InChI=1S/C10H23B2O3/c1-2-3-4-5-6-7-8-9-10-12(14)15-11-13/h13-14H,2-10H2,1H3 |
| InChIKey | SRWINGVQBOJUCK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.91 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 156634462 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156634462?
The IUPAC name of CID 156634462 (CID 156634462) is not available.
What is the SMILES notation for CID 156634462?
The canonical SMILES for CID 156634462 is CCCCCCCCCCB(O)O[B]O.
What is the InChIKey of CID 156634462?
The InChIKey is SRWINGVQBOJUCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23B2O3/c1-2-3-4-5-6-7-8-9-10-12(14)15-11-13/h13-14H,2-10H2,1H3.
What are the key properties of CID 156634462?
CID 156634462 has a molecular weight of 212.91 g/mol, XLogP of 2.15, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156634462 is sourced from PubChem (CID 156634462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).