aminooxy(pentyl)borinic acid

C5H14BNO2 — CID 88633345

IUPACaminooxy(pentyl)borinic acid
SMILESCCCCCB(O)ON
InChIInChI=1S/C5H14BNO2/c1-2-3-4-5-6(8)9-7/h8H,2-5,7H2,1H3
InChIKeyJRFWVMXZTAZNNX-UHFFFAOYSA-N
MW130.98 g/mol
LogP0.55
Rot. Bonds5

About aminooxy(pentyl)borinic acid

aminooxy(pentyl)borinic acid (PubChem CID 88633345) has the molecular formula C5H14BNO2 and a molecular weight of 130.98 g/mol. Its IUPAC name is aminooxy(pentyl)borinic acid.

Molecular Properties

Compound Nameaminooxy(pentyl)borinic acid
PubChem CID88633345
Molecular FormulaC5H14BNO2
Molecular Weight130.98 g/mol
Exact Mass131.11
IUPAC Nameaminooxy(pentyl)borinic acid
SMILESCCCCCB(O)ON
InChIInChI=1S/C5H14BNO2/c1-2-3-4-5-6(8)9-7/h8H,2-5,7H2,1H3
InChIKeyJRFWVMXZTAZNNX-UHFFFAOYSA-N
XLogP0.55
TPSA55.48 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500130.98
LogP ≤ 50.55
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze aminooxy(pentyl)borinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of aminooxy(pentyl)borinic acid?
The IUPAC name of aminooxy(pentyl)borinic acid (CID 88633345) is aminooxy(pentyl)borinic acid.
What is the SMILES notation for aminooxy(pentyl)borinic acid?
The canonical SMILES for aminooxy(pentyl)borinic acid is CCCCCB(O)ON.
What is the InChIKey of aminooxy(pentyl)borinic acid?
The InChIKey is JRFWVMXZTAZNNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14BNO2/c1-2-3-4-5-6(8)9-7/h8H,2-5,7H2,1H3.
What are the key properties of aminooxy(pentyl)borinic acid?
aminooxy(pentyl)borinic acid has a molecular weight of 130.98 g/mol, XLogP of 0.55, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aminooxy(pentyl)borinic acid is sourced from PubChem (CID 88633345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).