C10H16O2 — CID 12712267
5,5-dipropylfuran-2-one (PubChem CID 12712267) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 5,5-dipropylfuran-2-one.
| Compound Name | 5,5-dipropylfuran-2-one |
|---|---|
| PubChem CID | 12712267 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 5,5-dipropylfuran-2-one |
| SMILES | CCCC1(CCC)C=CC(=O)O1 |
| InChI | InChI=1S/C10H16O2/c1-3-6-10(7-4-2)8-5-9(11)12-10/h5,8H,3-4,6-7H2,1-2H3 |
| InChIKey | YEBPXYSQQWEJBW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |