C21H19N3O6 — CID 1271427
1-(1,3-benzodioxol-5-yl)-5-[(5-piperidin-1-ylfuran-2-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 1271427) has the molecular formula C21H19N3O6 and a molecular weight of 409.40 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-5-[(5-piperidin-1-ylfuran-2-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-5-[(5-piperidin-1-ylfuran-2-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 1271427 |
| Molecular Formula | C21H19N3O6 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-5-[(5-piperidin-1-ylfuran-2-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2ccc3c(c2)OCO3)C(=O)C1=Cc1ccc(N2CCCCC2)o1 |
| InChI | InChI=1S/C21H19N3O6/c25-19-15(11-14-5-7-18(30-14)23-8-2-1-3-9-23)20(26)24(21(27)22-19)13-4-6-16-17(10-13)29-12-28-16/h4-7,10-11H,1-3,8-9,12H2,(H,22,25,27) |
| InChIKey | UTOWQUZMHXAQNL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|