C23H13ClN2O8 — CID 21211130
4-[5-[(Z)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]-2-chlorobenzoic acid (PubChem CID 21211130) has the molecular formula C23H13ClN2O8 and a molecular weight of 480.82 g/mol. Its IUPAC name is 4-[5-[(Z)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]-2-chlorobenzoic acid.
| Compound Name | 4-[5-[(Z)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 21211130 |
| Molecular Formula | C23H13ClN2O8 |
| Molecular Weight | 480.82 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | 4-[5-[(Z)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]-2-chlorobenzoic acid |
| SMILES | O=C1NC(=O)N(c2ccc3c(c2)OCO3)C(=O)/C1=C\c1ccc(-c2ccc(C(=O)O)c(Cl)c2)o1 |
| InChI | InChI=1S/C23H13ClN2O8/c24-16-7-11(1-4-14(16)22(29)30)17-6-3-13(34-17)9-15-20(27)25-23(31)26(21(15)28)12-2-5-18-19(8-12)33-10-32-18/h1-9H,10H2,(H,29,30)(H,25,27,31)/b15-9- |
| InChIKey | UUJIHSLMJUTLMM-DHDCSXOGSA-N |
| XLogP | 3.69 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.82 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|