C24H10O11S — CID 12714695
13,13-dioxo-12-oxa-13λ6-thiahexacyclo[12.8.0.02,11.03,8.04,21.017,22]docosa-1(14),2(11),3,5,7,9,15,17,19,21-decaene-7,9,16,18-tetracarboxylic acid (PubChem CID 12714695) has the molecular formula C24H10O11S and a molecular weight of 506.40 g/mol. Its IUPAC name is 13,13-dioxo-12-oxa-13λ6-thiahexacyclo[12.8.0.02,11.03,8.04,21.017,22]docosa-1(14),2(11),3,5,7,9,15,17,19,21-decaene-7,9,16,18-tetracarboxylic acid.
| Compound Name | 13,13-dioxo-12-oxa-13λ6-thiahexacyclo[12.8.0.02,11.03,8.04,21.017,22]docosa-1(14),2(11),3,5,7,9,15,17,19,21-decaene-7,9,16,18-tetracarboxylic acid |
|---|---|
| PubChem CID | 12714695 |
| Molecular Formula | C24H10O11S |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 505.99 |
| IUPAC Name | 13,13-dioxo-12-oxa-13λ6-thiahexacyclo[12.8.0.02,11.03,8.04,21.017,22]docosa-1(14),2(11),3,5,7,9,15,17,19,21-decaene-7,9,16,18-tetracarboxylic acid |
| SMILES | O=C(O)c1ccc2c3ccc(C(=O)O)c4c(C(=O)O)cc5c(c6c(cc(C(=O)O)c1c26)OS5(=O)=O)c43 |
| InChI | InChI=1S/C24H10O11S/c25-21(26)9-3-1-7-8-2-4-10(22(27)28)16-12(24(31)32)6-14-20(18(8)16)19-13(35-36(14,33)34)5-11(23(29)30)15(9)17(7)19/h1-6H,(H,25,26)(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | PNWGUAIKQHORDY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 192.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|