C9H18N2O2S — CID 12715856
methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidothioate (PubChem CID 12715856) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidothioate.
| Compound Name | methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidothioate |
|---|---|
| PubChem CID | 12715856 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidothioate |
| SMILES | [H]/N=C(/CCNC(=O)OC(C)(C)C)SC |
| InChI | InChI=1S/C9H18N2O2S/c1-9(2,3)13-8(12)11-6-5-7(10)14-4/h10H,5-6H2,1-4H3,(H,11,12)/b10-7- |
| InChIKey | LHGLCFBIVPQCJL-YFHOEESVSA-N |
| XLogP | 2.24 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|