C12H20BrN3O3S — CID 155037409
[(E)-2-bromoprop-1-enyl] 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]ethanimidothioate (PubChem CID 155037409) has the molecular formula C12H20BrN3O3S and a molecular weight of 366.28 g/mol. Its IUPAC name is [(E)-2-bromoprop-1-enyl] 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]ethanimidothioate.
| Compound Name | [(E)-2-bromoprop-1-enyl] 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]ethanimidothioate |
|---|---|
| PubChem CID | 155037409 |
| Molecular Formula | C12H20BrN3O3S |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | [(E)-2-bromoprop-1-enyl] 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]ethanimidothioate |
| SMILES | [H]/N=C(/CNC(=O)CNC(=O)OC(C)(C)C)S/C=C(\C)Br |
| InChI | InChI=1S/C12H20BrN3O3S/c1-8(13)7-20-9(14)5-15-10(17)6-16-11(18)19-12(2,3)4/h7,14H,5-6H2,1-4H3,(H,15,17)(H,16,18)/b8-7+,14-9- |
| InChIKey | JJSIATZECBVZJE-ZHCWNNSNSA-N |
| XLogP | 2.59 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|