About (5,5-dioxo-[1]benzothiolo[3,2-b]pyridin-3-yl)-(2-hydroxyphenyl)methanone
(5,5-dioxo-[1]benzothiolo[3,2-b]pyridin-3-yl)-(2-hydroxyphenyl)methanone (PubChem CID 12717850) has the molecular formula C18H11NO4S
and a molecular weight of 337.36 g/mol. Its IUPAC name is (5,5-dioxo-[1]benzothiolo[3,2-b]pyridin-3-yl)-(2-hydroxyphenyl)methanone.
Molecular Properties
| Compound Name | (5,5-dioxo-[1]benzothiolo[3,2-b]pyridin-3-yl)-(2-hydroxyphenyl)methanone |
| PubChem CID | 12717850 |
| Molecular Formula | C18H11NO4S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | (5,5-dioxo-[1]benzothiolo[3,2-b]pyridin-3-yl)-(2-hydroxyphenyl)methanone |
| SMILES | O=C(c1cnc2c(c1)S(=O)(=O)c1ccccc1-2)c1ccccc1O |
| InChI | InChI=1S/C18H11NO4S/c20-14-7-3-1-5-12(14)18(21)11-9-16-17(19-10-11)13-6-2-4-8-15(13)24(16,22)23/h1-10,20H |
| InChIKey | VMPWREXKSDEOMP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5,5-dioxo-[1]benzothiolo[3,2-b]pyridin-3-yl)-(2-hydroxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,5-dioxo-[1]benzothiolo[3,2-b]pyridin-3-yl)-(2-hydroxyphenyl)methanone?
The IUPAC name of (5,5-dioxo-[1]benzothiolo[3,2-b]pyridin-3-yl)-(2-hydroxyphenyl)methanone (CID 12717850) is (5,5-dioxo-[1]benzothiolo[3,2-b]pyridin-3-yl)-(2-hydroxyphenyl)methanone.
What is the SMILES notation for (5,5-dioxo-[1]benzothiolo[3,2-b]pyridin-3-yl)-(2-hydroxyphenyl)methanone?
The canonical SMILES for (5,5-dioxo-[1]benzothiolo[3,2-b]pyridin-3-yl)-(2-hydroxyphenyl)methanone is O=C(c1cnc2c(c1)S(=O)(=O)c1ccccc1-2)c1ccccc1O.
What is the InChIKey of (5,5-dioxo-[1]benzothiolo[3,2-b]pyridin-3-yl)-(2-hydroxyphenyl)methanone?
The InChIKey is VMPWREXKSDEOMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11NO4S/c20-14-7-3-1-5-12(14)18(21)11-9-16-17(19-10-11)13-6-2-4-8-15(13)24(16,22)23/h1-10,20H.
What are the key properties of (5,5-dioxo-[1]benzothiolo[3,2-b]pyridin-3-yl)-(2-hydroxyphenyl)methanone?
(5,5-dioxo-[1]benzothiolo[3,2-b]pyridin-3-yl)-(2-hydroxyphenyl)methanone has a molecular weight of 337.36 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5,5-dioxo-[1]benzothiolo[3,2-b]pyridin-3-yl)-(2-hydroxyphenyl)methanone is sourced from PubChem (CID 12717850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).