C7H14N2S — CID 12718850
3-ethyl-N,5-dimethyl-1,3-thiazolidin-2-imine (PubChem CID 12718850) has the molecular formula C7H14N2S and a molecular weight of 158.27 g/mol. Its IUPAC name is 3-ethyl-N,5-dimethyl-1,3-thiazolidin-2-imine.
| Compound Name | 3-ethyl-N,5-dimethyl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 12718850 |
| Molecular Formula | C7H14N2S |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 3-ethyl-N,5-dimethyl-1,3-thiazolidin-2-imine |
| SMILES | CCN1CC(C)S/C1=N\C |
| InChI | InChI=1S/C7H14N2S/c1-4-9-5-6(2)10-7(9)8-3/h6H,4-5H2,1-3H3/b8-7- |
| InChIKey | ZQVYKDOLNWSKOJ-FPLPWBNLSA-N |
| XLogP | 1.43 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|