C16H29NO — CID 12721619
2-[(3,5,7-trimethyl-1-adamantyl)methylamino]ethanol (PubChem CID 12721619) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is 2-[(3,5,7-trimethyl-1-adamantyl)methylamino]ethanol.
| Compound Name | 2-[(3,5,7-trimethyl-1-adamantyl)methylamino]ethanol |
|---|---|
| PubChem CID | 12721619 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 2-[(3,5,7-trimethyl-1-adamantyl)methylamino]ethanol |
| SMILES | CC12CC3(C)CC(C)(C1)CC(CNCCO)(C2)C3 |
| InChI | InChI=1S/C16H29NO/c1-13-6-14(2)8-15(3,7-13)11-16(9-13,10-14)12-17-4-5-18/h17-18H,4-12H2,1-3H3 |
| InChIKey | SPGIJWBJWRDDGA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|