C12H11N3OS — CID 12724351
8-thia-10,12,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),9,11-tetraen-13-one (PubChem CID 12724351) has the molecular formula C12H11N3OS and a molecular weight of 245.31 g/mol. Its IUPAC name is 8-thia-10,12,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),9,11-tetraen-13-one.
| Compound Name | 8-thia-10,12,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),9,11-tetraen-13-one |
|---|---|
| PubChem CID | 12724351 |
| Molecular Formula | C12H11N3OS |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 8-thia-10,12,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),9,11-tetraen-13-one |
| SMILES | O=C1CN2C=c3c4c(sc3=NC2=N1)CCCC4 |
| InChI | InChI=1S/C12H11N3OS/c16-10-6-15-5-8-7-3-1-2-4-9(7)17-11(8)14-12(15)13-10/h5H,1-4,6H2 |
| InChIKey | LWAWEMFABJNIJI-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |