C11H10N4OS — CID 142735846
16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one (PubChem CID 142735846) has the molecular formula C11H10N4OS and a molecular weight of 246.29 g/mol. Its IUPAC name is 16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one.
| Compound Name | 16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one |
|---|---|
| PubChem CID | 142735846 |
| Molecular Formula | C11H10N4OS |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-8-one |
| SMILES | O=c1[nH]c2nncn2c2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C11H10N4OS/c16-9-8-6-3-1-2-4-7(6)17-10(8)15-5-12-14-11(15)13-9/h5H,1-4H2,(H,13,14,16) |
| InChIKey | CNNOOUVGMTWAGF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |