C10H9N5OS — CID 155808654
10-thia-3,4,5,6,8-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,11(16)-tetraen-7-one (PubChem CID 155808654) has the molecular formula C10H9N5OS and a molecular weight of 247.28 g/mol. Its IUPAC name is 10-thia-3,4,5,6,8-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,11(16)-tetraen-7-one.
| Compound Name | 10-thia-3,4,5,6,8-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,11(16)-tetraen-7-one |
|---|---|
| PubChem CID | 155808654 |
| Molecular Formula | C10H9N5OS |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 10-thia-3,4,5,6,8-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,11(16)-tetraen-7-one |
| SMILES | O=c1[nH]c2sc3c(c2c2nnnn12)CCCC3 |
| InChI | InChI=1S/C10H9N5OS/c16-10-11-9-7(8-12-13-14-15(8)10)5-3-1-2-4-6(5)17-9/h1-4H2,(H,11,16) |
| InChIKey | WFHMVMLXGZYQDT-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |