C20H17N5O2S — CID 135560707
4-[(12-oxo-9-thia-11,13,14,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),14,16-tetraen-15-yl)methoxy]benzonitrile (PubChem CID 135560707) has the molecular formula C20H17N5O2S and a molecular weight of 391.46 g/mol. Its IUPAC name is 4-[(12-oxo-9-thia-11,13,14,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),14,16-tetraen-15-yl)methoxy]benzonitrile.
| Compound Name | 4-[(12-oxo-9-thia-11,13,14,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),14,16-tetraen-15-yl)methoxy]benzonitrile |
|---|---|
| PubChem CID | 135560707 |
| Molecular Formula | C20H17N5O2S |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 4-[(12-oxo-9-thia-11,13,14,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),14,16-tetraen-15-yl)methoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCc2nc3c4c5c(sc4[nH]c(=O)n3n2)CCCCC5)cc1 |
| InChI | InChI=1S/C20H17N5O2S/c21-10-12-6-8-13(9-7-12)27-11-16-22-18-17-14-4-2-1-3-5-15(14)28-19(17)23-20(26)25(18)24-16/h6-9H,1-5,11H2,(H,23,26) |
| InChIKey | QJQBZSWJNABQBT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |