C19H15N5OS — CID 51390818
4-[(1R)-1-(10-thia-3,5,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaen-4-yl)ethoxy]benzonitrile (PubChem CID 51390818) has the molecular formula C19H15N5OS and a molecular weight of 361.43 g/mol. Its IUPAC name is 4-[(1R)-1-(10-thia-3,5,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaen-4-yl)ethoxy]benzonitrile.
| Compound Name | 4-[(1R)-1-(10-thia-3,5,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaen-4-yl)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 51390818 |
| Molecular Formula | C19H15N5OS |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 4-[(1R)-1-(10-thia-3,5,6,8-tetrazatetracyclo[7.6.0.02,6.011,15]pentadeca-1(9),2,4,7,11(15)-pentaen-4-yl)ethoxy]benzonitrile |
| SMILES | C[C@@H](Oc1ccc(C#N)cc1)c1nc2c3c4c(sc3ncn2n1)CCC4 |
| InChI | InChI=1S/C19H15N5OS/c1-11(25-13-7-5-12(9-20)6-8-13)17-22-18-16-14-3-2-4-15(14)26-19(16)21-10-24(18)23-17/h5-8,10-11H,2-4H2,1H3/t11-/m1/s1 |
| InChIKey | IRULMTUXKGHGGU-LLVKDONJSA-N |
| XLogP | 3.84 |
| TPSA | 76.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |