C18H16N4O2S — CID 135475082
4-(4-methoxyphenyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,11(16)-tetraen-7-one (PubChem CID 135475082) has the molecular formula C18H16N4O2S and a molecular weight of 352.42 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,11(16)-tetraen-7-one.
| Compound Name | 4-(4-methoxyphenyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,11(16)-tetraen-7-one |
|---|---|
| PubChem CID | 135475082 |
| Molecular Formula | C18H16N4O2S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 4-(4-methoxyphenyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,11(16)-tetraen-7-one |
| SMILES | COc1ccc(-c2nc3c4c5c(sc4[nH]c(=O)n3n2)CCCC5)cc1 |
| InChI | InChI=1S/C18H16N4O2S/c1-24-11-8-6-10(7-9-11)15-19-16-14-12-4-2-3-5-13(12)25-17(14)20-18(23)22(16)21-15/h6-9H,2-5H2,1H3,(H,20,23) |
| InChIKey | IWJCZCJXIGBHMZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |