C16H12N2O5 — CID 127252932
5-methoxy-4-oxo-N-(4-oxochromen-6-yl)-1H-pyridine-2-carboxamide (PubChem CID 127252932) has the molecular formula C16H12N2O5 and a molecular weight of 312.28 g/mol. Its IUPAC name is 5-methoxy-4-oxo-N-(4-oxochromen-6-yl)-1H-pyridine-2-carboxamide.
| Compound Name | 5-methoxy-4-oxo-N-(4-oxochromen-6-yl)-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 127252932 |
| Molecular Formula | C16H12N2O5 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 5-methoxy-4-oxo-N-(4-oxochromen-6-yl)-1H-pyridine-2-carboxamide |
| SMILES | COc1c[nH]c(C(=O)Nc2ccc3occc(=O)c3c2)cc1=O |
| InChI | InChI=1S/C16H12N2O5/c1-22-15-8-17-11(7-13(15)20)16(21)18-9-2-3-14-10(6-9)12(19)4-5-23-14/h2-8H,1H3,(H,17,20)(H,18,21) |
| InChIKey | RISCMCBSGUVIHR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |