C13H10F3N3O3 — CID 125433952
5-methoxy-4-oxo-N-[6-(trifluoromethyl)-3-pyridinyl]-1H-pyridine-2-carboxamide (PubChem CID 125433952) has the molecular formula C13H10F3N3O3 and a molecular weight of 313.24 g/mol. Its IUPAC name is 5-methoxy-4-oxo-N-[6-(trifluoromethyl)-3-pyridinyl]-1H-pyridine-2-carboxamide.
| Compound Name | 5-methoxy-4-oxo-N-[6-(trifluoromethyl)-3-pyridinyl]-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 125433952 |
| Molecular Formula | C13H10F3N3O3 |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 5-methoxy-4-oxo-N-[6-(trifluoromethyl)-3-pyridinyl]-1H-pyridine-2-carboxamide |
| SMILES | COc1c[nH]c(C(=O)Nc2ccc(C(F)(F)F)nc2)cc1=O |
| InChI | InChI=1S/C13H10F3N3O3/c1-22-10-6-17-8(4-9(10)20)12(21)19-7-2-3-11(18-5-7)13(14,15)16/h2-6H,1H3,(H,17,20)(H,19,21) |
| InChIKey | BEEKEDPEBSXAEU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |