C23H24ClN3O6S — CID 127253330
3-[[(2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3,3'-dioxospiro[1-benzofuran-2,4'-cyclohexene]-1'-yl]amino]-N-(4-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 127253330) has the molecular formula C23H24ClN3O6S and a molecular weight of 505.98 g/mol. Its IUPAC name is 3-[[(2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3,3'-dioxospiro[1-benzofuran-2,4'-cyclohexene]-1'-yl]amino]-N-(4-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[[(2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3,3'-dioxospiro[1-benzofuran-2,4'-cyclohexene]-1'-yl]amino]-N-(4-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 127253330 |
| Molecular Formula | C23H24ClN3O6S |
| Molecular Weight | 505.98 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 3-[[(2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3,3'-dioxospiro[1-benzofuran-2,4'-cyclohexene]-1'-yl]amino]-N-(4-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C=C(NCCC(=O)Nc3nc(C)cs3)C[C@H]1C)C2=O |
| InChI | InChI=1S/C23H24ClN3O6S/c1-11-7-13(25-6-5-17(29)27-22-26-12(2)10-34-22)8-16(28)23(11)21(30)18-14(31-3)9-15(32-4)19(24)20(18)33-23/h8-11,25H,5-7H2,1-4H3,(H,26,27,29)/t11-,23+/m1/s1 |
| InChIKey | CNDCXWPEGMCJEB-BGJPBQGDSA-N |
| XLogP | 3.55 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.98 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|