C24H22ClNO7 — CID 125429632
(2S,5'R)-3'-(3-acetyl-4-hydroxyanilino)-7-chloro-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione (PubChem CID 125429632) has the molecular formula C24H22ClNO7 and a molecular weight of 471.89 g/mol. Its IUPAC name is (2S,5'R)-3'-(3-acetyl-4-hydroxyanilino)-7-chloro-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione.
| Compound Name | (2S,5'R)-3'-(3-acetyl-4-hydroxyanilino)-7-chloro-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione |
|---|---|
| PubChem CID | 125429632 |
| Molecular Formula | C24H22ClNO7 |
| Molecular Weight | 471.89 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | (2S,5'R)-3'-(3-acetyl-4-hydroxyanilino)-7-chloro-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C=C(Nc3ccc(O)c(C(C)=O)c3)C[C@H]1C)C2=O |
| InChI | InChI=1S/C24H22ClNO7/c1-11-7-14(26-13-5-6-16(28)15(8-13)12(2)27)9-19(29)24(11)23(30)20-17(31-3)10-18(32-4)21(25)22(20)33-24/h5-6,8-11,26,28H,7H2,1-4H3/t11-,24+/m1/s1 |
| InChIKey | GWAYVGYILHUQER-JNDILOIQSA-N |
| XLogP | 4.18 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.89 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|