C25H25ClN2O7 — CID 125429961
5-[[(2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3,3'-dioxospiro[1-benzofuran-2,4'-cyclohexene]-1'-yl]amino]-2-(dimethylamino)benzoic acid (PubChem CID 125429961) has the molecular formula C25H25ClN2O7 and a molecular weight of 500.94 g/mol. Its IUPAC name is 5-[[(2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3,3'-dioxospiro[1-benzofuran-2,4'-cyclohexene]-1'-yl]amino]-2-(dimethylamino)benzoic acid.
| Compound Name | 5-[[(2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3,3'-dioxospiro[1-benzofuran-2,4'-cyclohexene]-1'-yl]amino]-2-(dimethylamino)benzoic acid |
|---|---|
| PubChem CID | 125429961 |
| Molecular Formula | C25H25ClN2O7 |
| Molecular Weight | 500.94 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 5-[[(2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3,3'-dioxospiro[1-benzofuran-2,4'-cyclohexene]-1'-yl]amino]-2-(dimethylamino)benzoic acid |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C=C(Nc3ccc(N(C)C)c(C(=O)O)c3)C[C@H]1C)C2=O |
| InChI | InChI=1S/C25H25ClN2O7/c1-12-8-14(27-13-6-7-16(28(2)3)15(9-13)24(31)32)10-19(29)25(12)23(30)20-17(33-4)11-18(34-5)21(26)22(20)35-25/h6-7,9-12,27H,8H2,1-5H3,(H,31,32)/t12-,25+/m1/s1 |
| InChIKey | UFQXNWYGLOLCOC-YDBLSZJJSA-N |
| XLogP | 4.04 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.94 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|