C23H20Cl2N2O6 — CID 163036289
2-chloro-4-[(7-chloro-4,6-dimethoxy-5'-methyl-3,3'-dioxospiro[1-benzofuran-2,4'-cyclohexene]-1'-yl)amino]benzamide (PubChem CID 163036289) has the molecular formula C23H20Cl2N2O6 and a molecular weight of 491.33 g/mol. Its IUPAC name is 2-chloro-4-[(7-chloro-4,6-dimethoxy-5'-methyl-3,3'-dioxospiro[1-benzofuran-2,4'-cyclohexene]-1'-yl)amino]benzamide.
| Compound Name | 2-chloro-4-[(7-chloro-4,6-dimethoxy-5'-methyl-3,3'-dioxospiro[1-benzofuran-2,4'-cyclohexene]-1'-yl)amino]benzamide |
|---|---|
| PubChem CID | 163036289 |
| Molecular Formula | C23H20Cl2N2O6 |
| Molecular Weight | 491.33 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | 2-chloro-4-[(7-chloro-4,6-dimethoxy-5'-methyl-3,3'-dioxospiro[1-benzofuran-2,4'-cyclohexene]-1'-yl)amino]benzamide |
| SMILES | COc1cc(OC)c2c(c1Cl)OC1(C(=O)C=C(Nc3ccc(C(N)=O)c(Cl)c3)CC1C)C2=O |
| InChI | InChI=1S/C23H20Cl2N2O6/c1-10-6-12(27-11-4-5-13(22(26)30)14(24)7-11)8-17(28)23(10)21(29)18-15(31-2)9-16(32-3)19(25)20(18)33-23/h4-5,7-10,27H,6H2,1-3H3,(H2,26,30) |
| InChIKey | BMNGYBZVQAXUTK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|