C22H20ClFN2O7 — CID 163125030
5-[[(2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3,3'-dioxospiro[1-benzofuran-2,4'-cyclohexene]-1'-yl]amino]-2-fluoro-N-hydroxybenzeneamine oxide (PubChem CID 163125030) has the molecular formula C22H20ClFN2O7 and a molecular weight of 478.86 g/mol. Its IUPAC name is 5-[[(2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3,3'-dioxospiro[1-benzofuran-2,4'-cyclohexene]-1'-yl]amino]-2-fluoro-N-hydroxybenzeneamine oxide.
| Compound Name | 5-[[(2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3,3'-dioxospiro[1-benzofuran-2,4'-cyclohexene]-1'-yl]amino]-2-fluoro-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163125030 |
| Molecular Formula | C22H20ClFN2O7 |
| Molecular Weight | 478.86 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 5-[[(2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3,3'-dioxospiro[1-benzofuran-2,4'-cyclohexene]-1'-yl]amino]-2-fluoro-N-hydroxybenzeneamine oxide |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C=C(Nc3ccc(F)c([NH+]([O-])O)c3)C[C@H]1C)C2=O |
| InChI | InChI=1S/C22H20ClFN2O7/c1-10-6-12(25-11-4-5-13(24)14(7-11)26(29)30)8-17(27)22(10)21(28)18-15(31-2)9-16(32-3)19(23)20(18)33-22/h4-5,7-10,25-26,29H,6H2,1-3H3/t10-,22+/m1/s1 |
| InChIKey | CYTPYJDXZJSPSH-STFLBKPXSA-N |
| XLogP | 2.82 |
| TPSA | 121.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.86 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|