C24H21ClN4O5 — CID 125429837
(2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3'-[3-(1H-1,2,4-triazol-5-yl)anilino]spiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione (PubChem CID 125429837) has the molecular formula C24H21ClN4O5 and a molecular weight of 480.91 g/mol. Its IUPAC name is (2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3'-[3-(1H-1,2,4-triazol-5-yl)anilino]spiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione.
| Compound Name | (2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3'-[3-(1H-1,2,4-triazol-5-yl)anilino]spiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione |
|---|---|
| PubChem CID | 125429837 |
| Molecular Formula | C24H21ClN4O5 |
| Molecular Weight | 480.91 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | (2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3'-[3-(1H-1,2,4-triazol-5-yl)anilino]spiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C=C(Nc3cccc(-c4ncn[nH]4)c3)C[C@H]1C)C2=O |
| InChI | InChI=1S/C24H21ClN4O5/c1-12-7-15(28-14-6-4-5-13(8-14)23-26-11-27-29-23)9-18(30)24(12)22(31)19-16(32-2)10-17(33-3)20(25)21(19)34-24/h4-6,8-12,28H,7H2,1-3H3,(H,26,27,29)/t12-,24+/m1/s1 |
| InChIKey | OPOXINYGOQRBNC-YYUOZPCZSA-N |
| XLogP | 4.06 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.91 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|