C24H24ClNO7 — CID 163025474
7-chloro-3'-[2-(3,4-dihydroxyphenyl)ethylamino]-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione (PubChem CID 163025474) has the molecular formula C24H24ClNO7 and a molecular weight of 473.91 g/mol. Its IUPAC name is 7-chloro-3'-[2-(3,4-dihydroxyphenyl)ethylamino]-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione.
| Compound Name | 7-chloro-3'-[2-(3,4-dihydroxyphenyl)ethylamino]-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione |
|---|---|
| PubChem CID | 163025474 |
| Molecular Formula | C24H24ClNO7 |
| Molecular Weight | 473.91 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 7-chloro-3'-[2-(3,4-dihydroxyphenyl)ethylamino]-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione |
| SMILES | COc1cc(OC)c2c(c1Cl)OC1(C(=O)C=C(NCCc3ccc(O)c(O)c3)CC1C)C2=O |
| InChI | InChI=1S/C24H24ClNO7/c1-12-8-14(26-7-6-13-4-5-15(27)16(28)9-13)10-19(29)24(12)23(30)20-17(31-2)11-18(32-3)21(25)22(20)33-24/h4-5,9-12,26-28H,6-8H2,1-3H3 |
| InChIKey | WFXUVBWWHZRUNY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.91 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|