C21H22ClN3O6 — CID 127253155
(2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3'-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]spiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione (PubChem CID 127253155) has the molecular formula C21H22ClN3O6 and a molecular weight of 447.88 g/mol. Its IUPAC name is (2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3'-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]spiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione.
| Compound Name | (2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3'-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]spiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione |
|---|---|
| PubChem CID | 127253155 |
| Molecular Formula | C21H22ClN3O6 |
| Molecular Weight | 447.88 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | (2S,5'R)-7-chloro-4,6-dimethoxy-5'-methyl-3'-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]spiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C=C(NCCc3nc(C)no3)C[C@H]1C)C2=O |
| InChI | InChI=1S/C21H22ClN3O6/c1-10-7-12(23-6-5-16-24-11(2)25-31-16)8-15(26)21(10)20(27)17-13(28-3)9-14(29-4)18(22)19(17)30-21/h8-10,23H,5-7H2,1-4H3/t10-,21+/m1/s1 |
| InChIKey | SJIRHLCAUCAPTN-UZJPJQLHSA-N |
| XLogP | 2.69 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.88 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|