C26H33ClN2O5 — CID 127253346
(2S,5'R)-3'-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]-7-chloro-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione (PubChem CID 127253346) has the molecular formula C26H33ClN2O5 and a molecular weight of 489.01 g/mol. Its IUPAC name is (2S,5'R)-3'-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]-7-chloro-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione.
| Compound Name | (2S,5'R)-3'-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]-7-chloro-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione |
|---|---|
| PubChem CID | 127253346 |
| Molecular Formula | C26H33ClN2O5 |
| Molecular Weight | 489.01 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | (2S,5'R)-3'-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]-7-chloro-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C=C(NC[C@@H]3CCCN4CCCC[C@H]34)C[C@H]1C)C2=O |
| InChI | InChI=1S/C26H33ClN2O5/c1-15-11-17(28-14-16-7-6-10-29-9-5-4-8-18(16)29)12-21(30)26(15)25(31)22-19(32-2)13-20(33-3)23(27)24(22)34-26/h12-13,15-16,18,28H,4-11,14H2,1-3H3/t15-,16+,18-,26+/m1/s1 |
| InChIKey | MXELYSDPGIWZBO-DCWOWMSHSA-N |
| XLogP | 4.02 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.01 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|