About 6-iodonaphthalen-2-amine;hydrochloride
6-iodonaphthalen-2-amine;hydrochloride (PubChem CID 127258958) has the molecular formula C10H9ClIN
and a molecular weight of 305.55 g/mol. Its IUPAC name is 6-iodonaphthalen-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 6-iodonaphthalen-2-amine;hydrochloride |
| PubChem CID | 127258958 |
| Molecular Formula | C10H9ClIN |
| Molecular Weight | 305.55 g/mol |
| Exact Mass | 304.95 |
| IUPAC Name | 6-iodonaphthalen-2-amine;hydrochloride |
| SMILES | Cl.Nc1ccc2cc(I)ccc2c1 |
| InChI | InChI=1S/C10H8IN.ClH/c11-9-3-1-8-6-10(12)4-2-7(8)5-9;/h1-6H,12H2;1H |
| InChIKey | NKVKNXCRYYPZIC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodonaphthalen-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodonaphthalen-2-amine;hydrochloride?
The IUPAC name of 6-iodonaphthalen-2-amine;hydrochloride (CID 127258958) is 6-iodonaphthalen-2-amine;hydrochloride.
What is the SMILES notation for 6-iodonaphthalen-2-amine;hydrochloride?
The canonical SMILES for 6-iodonaphthalen-2-amine;hydrochloride is Cl.Nc1ccc2cc(I)ccc2c1.
What is the InChIKey of 6-iodonaphthalen-2-amine;hydrochloride?
The InChIKey is NKVKNXCRYYPZIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8IN.ClH/c11-9-3-1-8-6-10(12)4-2-7(8)5-9;/h1-6H,12H2;1H.
What are the key properties of 6-iodonaphthalen-2-amine;hydrochloride?
6-iodonaphthalen-2-amine;hydrochloride has a molecular weight of 305.55 g/mol, XLogP of 3.45, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodonaphthalen-2-amine;hydrochloride is sourced from PubChem (CID 127258958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).