C24H40N2O8 — CID 127263574
bis(8,11-dioxa-3-azadispiro[4.1.47.35]tetradecane);oxalic acid (PubChem CID 127263574) has the molecular formula C24H40N2O8 and a molecular weight of 484.59 g/mol. Its IUPAC name is bis(8,11-dioxa-3-azadispiro[4.1.47.35]tetradecane);oxalic acid.
| Compound Name | bis(8,11-dioxa-3-azadispiro[4.1.47.35]tetradecane);oxalic acid |
|---|---|
| PubChem CID | 127263574 |
| Molecular Formula | C24H40N2O8 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | bis(8,11-dioxa-3-azadispiro[4.1.47.35]tetradecane);oxalic acid |
| SMILES | C1CC2(CCNC2)CC2(C1)OCCO2.C1CC2(CCNC2)CC2(C1)OCCO2.O=C(O)C(=O)O |
| InChI | InChI=1S/2C11H19NO2.C2H2O4/c2*1-2-10(4-5-12-9-10)8-11(3-1)13-6-7-14-11;3-1(4)2(5)6/h2*12H,1-9H2;(H,3,4)(H,5,6) |
| InChIKey | SAKULPIUWNOIGK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|