C20H32F4N2O4 — CID 127263576
bis(8,8-difluoro-2-azaspiro[4.5]decane);oxalic acid (PubChem CID 127263576) has the molecular formula C20H32F4N2O4 and a molecular weight of 440.48 g/mol. Its IUPAC name is bis(8,8-difluoro-2-azaspiro[4.5]decane);oxalic acid.
| Compound Name | bis(8,8-difluoro-2-azaspiro[4.5]decane);oxalic acid |
|---|---|
| PubChem CID | 127263576 |
| Molecular Formula | C20H32F4N2O4 |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | bis(8,8-difluoro-2-azaspiro[4.5]decane);oxalic acid |
| SMILES | FC1(F)CCC2(CCNC2)CC1.FC1(F)CCC2(CCNC2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/2C9H15F2N.C2H2O4/c2*10-9(11)3-1-8(2-4-9)5-6-12-7-8;3-1(4)2(5)6/h2*12H,1-7H2;(H,3,4)(H,5,6) |
| InChIKey | WRUOGZKSNRKCGA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|