C9H15NO5 — CID 171322884
2-oxa-7-azaspiro[4.4]nonane;oxalic acid (PubChem CID 171322884) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is 2-oxa-7-azaspiro[4.4]nonane;oxalic acid.
| Compound Name | 2-oxa-7-azaspiro[4.4]nonane;oxalic acid |
|---|---|
| PubChem CID | 171322884 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 2-oxa-7-azaspiro[4.4]nonane;oxalic acid |
| SMILES | C1CC2(CCOC2)CN1.O=C(O)C(=O)O |
| InChI | InChI=1S/C7H13NO.C2H2O4/c1-3-8-5-7(1)2-4-9-6-7;3-1(4)2(5)6/h8H,1-6H2;(H,3,4)(H,5,6) |
| InChIKey | DFYYSAUJGZOEGX-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|