About gold(1+);methylbenzene;triphenylphosphanium
gold(1+);methylbenzene;triphenylphosphanium (PubChem CID 127264320) has the molecular formula C25H23AuP+
and a molecular weight of 551.40 g/mol. Its IUPAC name is gold(1+);methylbenzene;triphenylphosphanium.
Molecular Properties
| Compound Name | gold(1+);methylbenzene;triphenylphosphanium |
| PubChem CID | 127264320 |
| Molecular Formula | C25H23AuP+ |
| Molecular Weight | 551.40 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | gold(1+);methylbenzene;triphenylphosphanium |
| SMILES | Cc1cc[c-]cc1.[Au+].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C7H7.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-5-3-2-4-6-7;/h1-15H;3-6H,1H3;/q;-1;+1/p+1 |
| InChIKey | NCNXDNNJANIBTQ-UHFFFAOYSA-O |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 551.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze gold(1+);methylbenzene;triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(1+);methylbenzene;triphenylphosphanium?
The IUPAC name of gold(1+);methylbenzene;triphenylphosphanium (CID 127264320) is gold(1+);methylbenzene;triphenylphosphanium.
What is the SMILES notation for gold(1+);methylbenzene;triphenylphosphanium?
The canonical SMILES for gold(1+);methylbenzene;triphenylphosphanium is Cc1cc[c-]cc1.[Au+].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of gold(1+);methylbenzene;triphenylphosphanium?
The InChIKey is NCNXDNNJANIBTQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H15P.C7H7.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-5-3-2-4-6-7;/h1-15H;3-6H,1H3;/q;-1;+1/p+1.
What are the key properties of gold(1+);methylbenzene;triphenylphosphanium?
gold(1+);methylbenzene;triphenylphosphanium has a molecular weight of 551.40 g/mol, XLogP of 4.97, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for gold(1+);methylbenzene;triphenylphosphanium is sourced from PubChem (CID 127264320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).