About carbanide;(4-methylphenyl)-diphenylphosphanium;palladium
carbanide;(4-methylphenyl)-diphenylphosphanium;palladium (PubChem CID 164850480) has the molecular formula C20H21PPd
and a molecular weight of 398.78 g/mol. Its IUPAC name is carbanide;(4-methylphenyl)-diphenylphosphanium;palladium.
Molecular Properties
| Compound Name | carbanide;(4-methylphenyl)-diphenylphosphanium;palladium |
| PubChem CID | 164850480 |
| Molecular Formula | C20H21PPd |
| Molecular Weight | 398.78 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | carbanide;(4-methylphenyl)-diphenylphosphanium;palladium |
| SMILES | Cc1ccc([PH+](c2ccccc2)c2ccccc2)cc1.[CH3-].[Pd] |
| InChI | InChI=1S/C19H17P.CH3.Pd/c1-16-12-14-19(15-13-16)20(17-8-4-2-5-9-17)18-10-6-3-7-11-18;;/h2-15H,1H3;1H3;/q;-1;/p+1 |
| InChIKey | TZBHPELIRSBETH-UHFFFAOYSA-O |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.78 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbanide;(4-methylphenyl)-diphenylphosphanium;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;(4-methylphenyl)-diphenylphosphanium;palladium?
The IUPAC name of carbanide;(4-methylphenyl)-diphenylphosphanium;palladium (CID 164850480) is carbanide;(4-methylphenyl)-diphenylphosphanium;palladium.
What is the SMILES notation for carbanide;(4-methylphenyl)-diphenylphosphanium;palladium?
The canonical SMILES for carbanide;(4-methylphenyl)-diphenylphosphanium;palladium is Cc1ccc([PH+](c2ccccc2)c2ccccc2)cc1.[CH3-].[Pd].
What is the InChIKey of carbanide;(4-methylphenyl)-diphenylphosphanium;palladium?
The InChIKey is TZBHPELIRSBETH-UHFFFAOYSA-O. The full InChI is InChI=1S/C19H17P.CH3.Pd/c1-16-12-14-19(15-13-16)20(17-8-4-2-5-9-17)18-10-6-3-7-11-18;;/h2-15H,1H3;1H3;/q;-1;/p+1.
What are the key properties of carbanide;(4-methylphenyl)-diphenylphosphanium;palladium?
carbanide;(4-methylphenyl)-diphenylphosphanium;palladium has a molecular weight of 398.78 g/mol, XLogP of 3.93, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;(4-methylphenyl)-diphenylphosphanium;palladium is sourced from PubChem (CID 164850480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).