C16H20N2O2S — CID 127266515
2-[1-[4-(3-methoxyphenyl)but-3-enylsulfanyl]ethyl]-5-methyl-1,3,4-oxadiazole (PubChem CID 127266515) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is 2-[1-[4-(3-methoxyphenyl)but-3-enylsulfanyl]ethyl]-5-methyl-1,3,4-oxadiazole.
| Compound Name | 2-[1-[4-(3-methoxyphenyl)but-3-enylsulfanyl]ethyl]-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 127266515 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-[1-[4-(3-methoxyphenyl)but-3-enylsulfanyl]ethyl]-5-methyl-1,3,4-oxadiazole |
| SMILES | COc1cccc(C=CCCSC(C)c2nnc(C)o2)c1 |
| InChI | InChI=1S/C16H20N2O2S/c1-12(16-18-17-13(2)20-16)21-10-5-4-7-14-8-6-9-15(11-14)19-3/h4,6-9,11-12H,5,10H2,1-3H3 |
| InChIKey | ORVJOUHCZNTLRW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|