C12H15NO3S — CID 127266845
2-ethyl-N-(4-hydroxybut-2-ynyl)benzenesulfonamide (PubChem CID 127266845) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is 2-ethyl-N-(4-hydroxybut-2-ynyl)benzenesulfonamide.
| Compound Name | 2-ethyl-N-(4-hydroxybut-2-ynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 127266845 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 2-ethyl-N-(4-hydroxybut-2-ynyl)benzenesulfonamide |
| SMILES | CCc1ccccc1S(=O)(=O)NCC#CCO |
| InChI | InChI=1S/C12H15NO3S/c1-2-11-7-3-4-8-12(11)17(15,16)13-9-5-6-10-14/h3-4,7-8,13-14H,2,9-10H2,1H3 |
| InChIKey | TYQIOUULTLDUJI-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|