C13H19NO5S — CID 126815845
methyl 2-[(2-ethylphenyl)sulfonylamino]-3-hydroxy-2-methylpropanoate (PubChem CID 126815845) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is methyl 2-[(2-ethylphenyl)sulfonylamino]-3-hydroxy-2-methylpropanoate.
| Compound Name | methyl 2-[(2-ethylphenyl)sulfonylamino]-3-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 126815845 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | methyl 2-[(2-ethylphenyl)sulfonylamino]-3-hydroxy-2-methylpropanoate |
| SMILES | CCc1ccccc1S(=O)(=O)NC(C)(CO)C(=O)OC |
| InChI | InChI=1S/C13H19NO5S/c1-4-10-7-5-6-8-11(10)20(17,18)14-13(2,9-15)12(16)19-3/h5-8,14-15H,4,9H2,1-3H3 |
| InChIKey | LMMMQUBTCYXDLZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |