C17H23N3O3S — CID 127266985
N-[5-[1-(2-methoxy-4-pyridinyl)propan-2-ylamino]-2-methylphenyl]methanesulfonamide (PubChem CID 127266985) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is N-[5-[1-(2-methoxy-4-pyridinyl)propan-2-ylamino]-2-methylphenyl]methanesulfonamide.
| Compound Name | N-[5-[1-(2-methoxy-4-pyridinyl)propan-2-ylamino]-2-methylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 127266985 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-[5-[1-(2-methoxy-4-pyridinyl)propan-2-ylamino]-2-methylphenyl]methanesulfonamide |
| SMILES | COc1cc(CC(C)Nc2ccc(C)c(NS(C)(=O)=O)c2)ccn1 |
| InChI | InChI=1S/C17H23N3O3S/c1-12-5-6-15(11-16(12)20-24(4,21)22)19-13(2)9-14-7-8-18-17(10-14)23-3/h5-8,10-11,13,19-20H,9H2,1-4H3 |
| InChIKey | FSFRYHTVRWOOGA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |