C18H24N2O3S — CID 75509356
N-[5-[4-(4-hydroxyphenyl)butan-2-ylamino]-2-methylphenyl]methanesulfonamide (PubChem CID 75509356) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is N-[5-[4-(4-hydroxyphenyl)butan-2-ylamino]-2-methylphenyl]methanesulfonamide.
| Compound Name | N-[5-[4-(4-hydroxyphenyl)butan-2-ylamino]-2-methylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 75509356 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-[5-[4-(4-hydroxyphenyl)butan-2-ylamino]-2-methylphenyl]methanesulfonamide |
| SMILES | Cc1ccc(NC(C)CCc2ccc(O)cc2)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C18H24N2O3S/c1-13-4-9-16(12-18(13)20-24(3,22)23)19-14(2)5-6-15-7-10-17(21)11-8-15/h4,7-12,14,19-21H,5-6H2,1-3H3 |
| InChIKey | URJPEPXTPKUGAW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |