C14H25FN2O3 — CID 127267487
2-fluoro-2-[1-(2-pentoxyacetyl)piperidin-4-yl]acetamide (PubChem CID 127267487) has the molecular formula C14H25FN2O3 and a molecular weight of 288.36 g/mol. Its IUPAC name is 2-fluoro-2-[1-(2-pentoxyacetyl)piperidin-4-yl]acetamide.
| Compound Name | 2-fluoro-2-[1-(2-pentoxyacetyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 127267487 |
| Molecular Formula | C14H25FN2O3 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-fluoro-2-[1-(2-pentoxyacetyl)piperidin-4-yl]acetamide |
| SMILES | CCCCCOCC(=O)N1CCC(C(F)C(N)=O)CC1 |
| InChI | InChI=1S/C14H25FN2O3/c1-2-3-4-9-20-10-12(18)17-7-5-11(6-8-17)13(15)14(16)19/h11,13H,2-10H2,1H3,(H2,16,19) |
| InChIKey | HJSIGGLUUVFMMD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|