About 1-methyl-N-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]pyrrole-2-carboxamide
1-methyl-N-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]pyrrole-2-carboxamide (PubChem CID 127267523) has the molecular formula C13H13F3N4O2
and a molecular weight of 314.27 g/mol. Its IUPAC name is 1-methyl-N-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 1-methyl-N-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]pyrrole-2-carboxamide |
| PubChem CID | 127267523 |
| Molecular Formula | C13H13F3N4O2 |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 1-methyl-N-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]pyrrole-2-carboxamide |
| SMILES | Cn1cccc1C(=O)NCc1ccc(OCC(F)(F)F)nn1 |
| InChI | InChI=1S/C13H13F3N4O2/c1-20-6-2-3-10(20)12(21)17-7-9-4-5-11(19-18-9)22-8-13(14,15)16/h2-6H,7-8H2,1H3,(H,17,21) |
| InChIKey | IRFSUUOIRVVKAK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-N-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]pyrrole-2-carboxamide?
The IUPAC name of 1-methyl-N-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]pyrrole-2-carboxamide (CID 127267523) is 1-methyl-N-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]pyrrole-2-carboxamide.
What is the SMILES notation for 1-methyl-N-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]pyrrole-2-carboxamide?
The canonical SMILES for 1-methyl-N-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]pyrrole-2-carboxamide is Cn1cccc1C(=O)NCc1ccc(OCC(F)(F)F)nn1.
What is the InChIKey of 1-methyl-N-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]pyrrole-2-carboxamide?
The InChIKey is IRFSUUOIRVVKAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F3N4O2/c1-20-6-2-3-10(20)12(21)17-7-9-4-5-11(19-18-9)22-8-13(14,15)16/h2-6H,7-8H2,1H3,(H,17,21).
What are the key properties of 1-methyl-N-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]pyrrole-2-carboxamide?
1-methyl-N-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]pyrrole-2-carboxamide has a molecular weight of 314.27 g/mol, XLogP of 1.69, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-[[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]methyl]pyrrole-2-carboxamide is sourced from PubChem (CID 127267523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).